C24H20FN5O7P+ — CID 163913981
(N-[4-(2-carboxy-6-fluorophenyl)-5-oxotetrazole-1-carbonyl]-4-methoxy-3-phenylmethoxycarbonylanilino)phosphanium (PubChem CID 163913981) has the molecular formula C24H20FN5O7P+ and a molecular weight of 540.42 g/mol. Its IUPAC name is (N-[4-(2-carboxy-6-fluorophenyl)-5-oxotetrazole-1-carbonyl]-4-methoxy-3-phenylmethoxycarbonylanilino)phosphanium.
| Compound Name | (N-[4-(2-carboxy-6-fluorophenyl)-5-oxotetrazole-1-carbonyl]-4-methoxy-3-phenylmethoxycarbonylanilino)phosphanium |
|---|---|
| PubChem CID | 163913981 |
| Molecular Formula | C24H20FN5O7P+ |
| Molecular Weight | 540.42 g/mol |
| Exact Mass | 540.11 |
| IUPAC Name | (N-[4-(2-carboxy-6-fluorophenyl)-5-oxotetrazole-1-carbonyl]-4-methoxy-3-phenylmethoxycarbonylanilino)phosphanium |
| SMILES | COc1ccc(N([PH3+])C(=O)n2nnn(-c3c(F)cccc3C(=O)O)c2=O)cc1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H19FN5O7P/c1-36-19-11-10-15(12-17(19)22(33)37-13-14-6-3-2-4-7-14)30(38)24(35)29-23(34)28(26-27-29)20-16(21(31)32)8-5-9-18(20)25/h2-12H,13,38H2,1H3,(H,31,32)/p+1 |
| InChIKey | QUQABWBEESMTBH-UHFFFAOYSA-O |
| XLogP | 2.63 |
| TPSA | 145.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|