C26H25N5O6 — CID 58502217
benzyl 5-[ethyl-[4-(2-methoxyphenyl)-5-oxotetrazole-1-carbonyl]amino]-2-methoxybenzoate (PubChem CID 58502217) has the molecular formula C26H25N5O6 and a molecular weight of 503.52 g/mol. Its IUPAC name is benzyl 5-[ethyl-[4-(2-methoxyphenyl)-5-oxotetrazole-1-carbonyl]amino]-2-methoxybenzoate.
| Compound Name | benzyl 5-[ethyl-[4-(2-methoxyphenyl)-5-oxotetrazole-1-carbonyl]amino]-2-methoxybenzoate |
|---|---|
| PubChem CID | 58502217 |
| Molecular Formula | C26H25N5O6 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | benzyl 5-[ethyl-[4-(2-methoxyphenyl)-5-oxotetrazole-1-carbonyl]amino]-2-methoxybenzoate |
| SMILES | CCN(C(=O)n1nnn(-c2ccccc2OC)c1=O)c1ccc(OC)c(C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C26H25N5O6/c1-4-29(25(33)31-26(34)30(27-28-31)21-12-8-9-13-23(21)36-3)19-14-15-22(35-2)20(16-19)24(32)37-17-18-10-6-5-7-11-18/h5-16H,4,17H2,1-3H3 |
| InChIKey | BTOBTFKWDQTPNE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 117.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|