C19H21N5O3 — CID 58502440
N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide (PubChem CID 58502440) has the molecular formula C19H21N5O3 and a molecular weight of 367.41 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide.
| Compound Name | N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide |
|---|---|
| PubChem CID | 58502440 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide |
| SMILES | CCN(C(=O)n1nnn(-c2ccccc2OC)c1=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C19H21N5O3/c1-5-22(16-12-13(2)10-11-14(16)3)18(25)24-19(26)23(20-21-24)15-8-6-7-9-17(15)27-4/h6-12H,5H2,1-4H3 |
| InChIKey | RHEVTEGCKPEJNK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|