About N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide
N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide (PubChem CID 58502440) has the molecular formula C19H21N5O3
and a molecular weight of 367.41 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide.
Molecular Properties
| Compound Name | N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide |
| PubChem CID | 58502440 |
| Molecular Formula | C19H21N5O3 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide |
| SMILES | CCN(C(=O)n1nnn(-c2ccccc2OC)c1=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C19H21N5O3/c1-5-22(16-12-13(2)10-11-14(16)3)18(25)24-19(26)23(20-21-24)15-8-6-7-9-17(15)27-4/h6-12H,5H2,1-4H3 |
| InChIKey | RHEVTEGCKPEJNK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|
Analyze N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide?
The IUPAC name of N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide (CID 58502440) is N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide.
What is the SMILES notation for N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide?
The canonical SMILES for N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide is CCN(C(=O)n1nnn(-c2ccccc2OC)c1=O)c1cc(C)ccc1C.
What is the InChIKey of N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide?
The InChIKey is RHEVTEGCKPEJNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N5O3/c1-5-22(16-12-13(2)10-11-14(16)3)18(25)24-19(26)23(20-21-24)15-8-6-7-9-17(15)27-4/h6-12H,5H2,1-4H3.
What are the key properties of N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide?
N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide has a molecular weight of 367.41 g/mol, XLogP of 2.55, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dimethylphenyl)-N-ethyl-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide is sourced from PubChem (CID 58502440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).