C22H18FN5O3 — CID 58502221
N-ethyl-N-(2-fluorophenyl)-5-oxo-4-(2-phenoxyphenyl)tetrazole-1-carboxamide (PubChem CID 58502221) has the molecular formula C22H18FN5O3 and a molecular weight of 419.42 g/mol. Its IUPAC name is N-ethyl-N-(2-fluorophenyl)-5-oxo-4-(2-phenoxyphenyl)tetrazole-1-carboxamide.
| Compound Name | N-ethyl-N-(2-fluorophenyl)-5-oxo-4-(2-phenoxyphenyl)tetrazole-1-carboxamide |
|---|---|
| PubChem CID | 58502221 |
| Molecular Formula | C22H18FN5O3 |
| Molecular Weight | 419.42 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | N-ethyl-N-(2-fluorophenyl)-5-oxo-4-(2-phenoxyphenyl)tetrazole-1-carboxamide |
| SMILES | CCN(C(=O)n1nnn(-c2ccccc2Oc2ccccc2)c1=O)c1ccccc1F |
| InChI | InChI=1S/C22H18FN5O3/c1-2-26(18-13-7-6-12-17(18)23)21(29)28-22(30)27(24-25-28)19-14-8-9-15-20(19)31-16-10-4-3-5-11-16/h3-15H,2H2,1H3 |
| InChIKey | BQLAWOBOKXDDIO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 82.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|