C18H17N5O5 — CID 88881788
N-ethyl-N-(5-formyl-2-hydroxyphenyl)-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide (PubChem CID 88881788) has the molecular formula C18H17N5O5 and a molecular weight of 383.36 g/mol. Its IUPAC name is N-ethyl-N-(5-formyl-2-hydroxyphenyl)-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide.
| Compound Name | N-ethyl-N-(5-formyl-2-hydroxyphenyl)-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide |
|---|---|
| PubChem CID | 88881788 |
| Molecular Formula | C18H17N5O5 |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | N-ethyl-N-(5-formyl-2-hydroxyphenyl)-4-(2-methoxyphenyl)-5-oxotetrazole-1-carboxamide |
| SMILES | CCN(C(=O)n1nnn(-c2ccccc2OC)c1=O)c1cc(C=O)ccc1O |
| InChI | InChI=1S/C18H17N5O5/c1-3-21(14-10-12(11-24)8-9-15(14)25)17(26)23-18(27)22(19-20-23)13-6-4-5-7-16(13)28-2/h4-11,25H,3H2,1-2H3 |
| InChIKey | DOIPYFZLHPDKFR-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|