C12H12N2O4 — CID 82419462
5-hydroxy-6-(hydroxymethyl)-2-(2-methoxyphenyl)pyridazin-3-one (PubChem CID 82419462) has the molecular formula C12H12N2O4 and a molecular weight of 248.24 g/mol. Its IUPAC name is 5-hydroxy-6-(hydroxymethyl)-2-(2-methoxyphenyl)pyridazin-3-one.
| Compound Name | 5-hydroxy-6-(hydroxymethyl)-2-(2-methoxyphenyl)pyridazin-3-one |
|---|---|
| PubChem CID | 82419462 |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 5-hydroxy-6-(hydroxymethyl)-2-(2-methoxyphenyl)pyridazin-3-one |
| SMILES | COc1ccccc1-n1nc(CO)c(O)cc1=O |
| InChI | InChI=1S/C12H12N2O4/c1-18-11-5-3-2-4-9(11)14-12(17)6-10(16)8(7-15)13-14/h2-6,15-16H,7H2,1H3 |
| InChIKey | ZXSQYJCOKNXTBT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |