C12H12N2O2S — CID 82419557
5-hydroxy-2-(2-methylphenyl)-6-(sulfanylmethyl)pyridazin-3-one (PubChem CID 82419557) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 5-hydroxy-2-(2-methylphenyl)-6-(sulfanylmethyl)pyridazin-3-one.
| Compound Name | 5-hydroxy-2-(2-methylphenyl)-6-(sulfanylmethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 82419557 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 5-hydroxy-2-(2-methylphenyl)-6-(sulfanylmethyl)pyridazin-3-one |
| SMILES | Cc1ccccc1-n1nc(CS)c(O)cc1=O |
| InChI | InChI=1S/C12H12N2O2S/c1-8-4-2-3-5-10(8)14-12(16)6-11(15)9(7-17)13-14/h2-6,15,17H,7H2,1H3 |
| InChIKey | OLJSQTVHJCRTHG-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|