C14H16FN3O2 — CID 82421632
2-(2-fluorophenyl)-5-hydroxy-6-(propylaminomethyl)pyridazin-3-one (PubChem CID 82421632) has the molecular formula C14H16FN3O2 and a molecular weight of 277.30 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-5-hydroxy-6-(propylaminomethyl)pyridazin-3-one.
| Compound Name | 2-(2-fluorophenyl)-5-hydroxy-6-(propylaminomethyl)pyridazin-3-one |
|---|---|
| PubChem CID | 82421632 |
| Molecular Formula | C14H16FN3O2 |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 2-(2-fluorophenyl)-5-hydroxy-6-(propylaminomethyl)pyridazin-3-one |
| SMILES | CCCNCc1nn(-c2ccccc2F)c(=O)cc1O |
| InChI | InChI=1S/C14H16FN3O2/c1-2-7-16-9-11-13(19)8-14(20)18(17-11)12-6-4-3-5-10(12)15/h3-6,8,16,19H,2,7,9H2,1H3 |
| InChIKey | RXSAYVALMFGPAT-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|