C17H23N3O2 — CID 82419180
6-(butylaminomethyl)-2-(2,4-dimethylphenyl)-5-hydroxypyridazin-3-one (PubChem CID 82419180) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 6-(butylaminomethyl)-2-(2,4-dimethylphenyl)-5-hydroxypyridazin-3-one.
| Compound Name | 6-(butylaminomethyl)-2-(2,4-dimethylphenyl)-5-hydroxypyridazin-3-one |
|---|---|
| PubChem CID | 82419180 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | 6-(butylaminomethyl)-2-(2,4-dimethylphenyl)-5-hydroxypyridazin-3-one |
| SMILES | CCCCNCc1nn(-c2ccc(C)cc2C)c(=O)cc1O |
| InChI | InChI=1S/C17H23N3O2/c1-4-5-8-18-11-14-16(21)10-17(22)20(19-14)15-7-6-12(2)9-13(15)3/h6-7,9-10,18,21H,4-5,8,11H2,1-3H3 |
| InChIKey | NEVYZIWPKWGPLF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|