C13H13ClN2O4 — CID 82420697
6-(chloromethyl)-2-(2,5-dimethoxyphenyl)-5-hydroxypyridazin-3-one (PubChem CID 82420697) has the molecular formula C13H13ClN2O4 and a molecular weight of 296.71 g/mol. Its IUPAC name is 6-(chloromethyl)-2-(2,5-dimethoxyphenyl)-5-hydroxypyridazin-3-one.
| Compound Name | 6-(chloromethyl)-2-(2,5-dimethoxyphenyl)-5-hydroxypyridazin-3-one |
|---|---|
| PubChem CID | 82420697 |
| Molecular Formula | C13H13ClN2O4 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 6-(chloromethyl)-2-(2,5-dimethoxyphenyl)-5-hydroxypyridazin-3-one |
| SMILES | COc1ccc(OC)c(-n2nc(CCl)c(O)cc2=O)c1 |
| InChI | InChI=1S/C13H13ClN2O4/c1-19-8-3-4-12(20-2)10(5-8)16-13(18)6-11(17)9(7-14)15-16/h3-6,17H,7H2,1-2H3 |
| InChIKey | XZXNLATYLVSASC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|