C17H15F2N5O3 — CID 70668188
4-(2,6-difluorophenyl)-N-ethyl-N-(2-hydroxy-5-methylphenyl)-5-oxotetrazole-1-carboxamide (PubChem CID 70668188) has the molecular formula C17H15F2N5O3 and a molecular weight of 375.34 g/mol. Its IUPAC name is 4-(2,6-difluorophenyl)-N-ethyl-N-(2-hydroxy-5-methylphenyl)-5-oxotetrazole-1-carboxamide.
| Compound Name | 4-(2,6-difluorophenyl)-N-ethyl-N-(2-hydroxy-5-methylphenyl)-5-oxotetrazole-1-carboxamide |
|---|---|
| PubChem CID | 70668188 |
| Molecular Formula | C17H15F2N5O3 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | 4-(2,6-difluorophenyl)-N-ethyl-N-(2-hydroxy-5-methylphenyl)-5-oxotetrazole-1-carboxamide |
| SMILES | CCN(C(=O)n1nnn(-c2c(F)cccc2F)c1=O)c1cc(C)ccc1O |
| InChI | InChI=1S/C17H15F2N5O3/c1-3-22(13-9-10(2)7-8-14(13)25)16(26)24-17(27)23(20-21-24)15-11(18)5-4-6-12(15)19/h4-9,25H,3H2,1-2H3 |
| InChIKey | AFAGKHFSJLSABQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'amidotetrazole', 'substructure': 'N/A'} |
|---|