C20H22FN5O5 — CID 126499001
3-[tert-butyl-[[4-(2-fluoro-6-methoxyphenyl)-5-oxotetrazol-1-yl]-hydroxymethyl]amino]benzoic acid (PubChem CID 126499001) has the molecular formula C20H22FN5O5 and a molecular weight of 431.42 g/mol. Its IUPAC name is 3-[tert-butyl-[[4-(2-fluoro-6-methoxyphenyl)-5-oxotetrazol-1-yl]-hydroxymethyl]amino]benzoic acid.
| Compound Name | 3-[tert-butyl-[[4-(2-fluoro-6-methoxyphenyl)-5-oxotetrazol-1-yl]-hydroxymethyl]amino]benzoic acid |
|---|---|
| PubChem CID | 126499001 |
| Molecular Formula | C20H22FN5O5 |
| Molecular Weight | 431.42 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 3-[tert-butyl-[[4-(2-fluoro-6-methoxyphenyl)-5-oxotetrazol-1-yl]-hydroxymethyl]amino]benzoic acid |
| SMILES | COc1cccc(F)c1-n1nnn(C(O)N(c2cccc(C(=O)O)c2)C(C)(C)C)c1=O |
| InChI | InChI=1S/C20H22FN5O5/c1-20(2,3)24(13-8-5-7-12(11-13)17(27)28)18(29)26-19(30)25(22-23-26)16-14(21)9-6-10-15(16)31-4/h5-11,18,29H,1-4H3,(H,27,28) |
| InChIKey | PUEOXGBQFQJQGR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 122.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.42 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|