C13H11FN2O5 — CID 163289182
methyl 1-(2-fluoro-6-methoxyphenyl)-4-hydroxy-6-oxopyridazine-3-carboxylate (PubChem CID 163289182) has the molecular formula C13H11FN2O5 and a molecular weight of 294.24 g/mol. Its IUPAC name is methyl 1-(2-fluoro-6-methoxyphenyl)-4-hydroxy-6-oxopyridazine-3-carboxylate.
| Compound Name | methyl 1-(2-fluoro-6-methoxyphenyl)-4-hydroxy-6-oxopyridazine-3-carboxylate |
|---|---|
| PubChem CID | 163289182 |
| Molecular Formula | C13H11FN2O5 |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | methyl 1-(2-fluoro-6-methoxyphenyl)-4-hydroxy-6-oxopyridazine-3-carboxylate |
| SMILES | COC(=O)c1nn(-c2c(F)cccc2OC)c(=O)cc1O |
| InChI | InChI=1S/C13H11FN2O5/c1-20-9-5-3-4-7(14)12(9)16-10(18)6-8(17)11(15-16)13(19)21-2/h3-6,17H,1-2H3 |
| InChIKey | VWPWXLGVDDVUQW-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |