C6H13N5 — CID 148575149
N-[(E)-1-amino-1-(aminomethylideneamino)prop-1-en-2-yl]-N'-methylmethanimidamide (PubChem CID 148575149) has the molecular formula C6H13N5 and a molecular weight of 155.20 g/mol. Its IUPAC name is N-[(E)-1-amino-1-(aminomethylideneamino)prop-1-en-2-yl]-N'-methylmethanimidamide.
| Compound Name | N-[(E)-1-amino-1-(aminomethylideneamino)prop-1-en-2-yl]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 148575149 |
| Molecular Formula | C6H13N5 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.12 |
| IUPAC Name | N-[(E)-1-amino-1-(aminomethylideneamino)prop-1-en-2-yl]-N'-methylmethanimidamide |
| SMILES | C/N=C/N/C(C)=C(\N)N=CN |
| InChI | InChI=1S/C6H13N5/c1-5(11-4-9-2)6(8)10-3-7/h3-4H,8H2,1-2H3,(H2,7,10)(H,9,11)/b6-5+ |
| InChIKey | MXQMJSYRQVDZOW-AATRIKPKSA-N |
| XLogP | -0.63 |
| TPSA | 88.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|