C5H8N2W — CID 54681562
carbanide;5-methyl-1,4-dihydroimidazol-4-ide;tungsten(2+) (PubChem CID 54681562) has the molecular formula C5H8N2W and a molecular weight of 279.97 g/mol. Its IUPAC name is carbanide;5-methyl-1,4-dihydroimidazol-4-ide;tungsten(2+).
| Compound Name | carbanide;5-methyl-1,4-dihydroimidazol-4-ide;tungsten(2+) |
|---|---|
| PubChem CID | 54681562 |
| Molecular Formula | C5H8N2W |
| Molecular Weight | 279.97 g/mol |
| Exact Mass | 280.02 |
| IUPAC Name | carbanide;5-methyl-1,4-dihydroimidazol-4-ide;tungsten(2+) |
| SMILES | Cc1[c-]nc[nH]1.[CH3-].[W+2] |
| InChI | InChI=1S/C4H5N2.CH3.W/c1-4-2-5-3-6-4;;/h3H,1H3,(H,5,6);1H3;/q2*-1;+2 |
| InChIKey | MBXADUDXVCLTPU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.97 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|