C7H12N2 — CID 123891901
N,N'-bis(prop-1-en-2-yl)methanimidamide (PubChem CID 123891901) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is N,N'-bis(prop-1-en-2-yl)methanimidamide.
| Compound Name | N,N'-bis(prop-1-en-2-yl)methanimidamide |
|---|---|
| PubChem CID | 123891901 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | N,N'-bis(prop-1-en-2-yl)methanimidamide |
| SMILES | C=C(C)/N=C/NC(=C)C |
| InChI | InChI=1S/C7H12N2/c1-6(2)8-5-9-7(3)4/h5H,1,3H2,2,4H3,(H,8,9) |
| InChIKey | OOHADHSHUDSJTN-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|