C6H12N2+2 — CID 58187923
1,3,5-trimethyl-1H-imidazole-1,3-diium (PubChem CID 58187923) has the molecular formula C6H12N2+2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 1,3,5-trimethyl-1H-imidazole-1,3-diium.
| Compound Name | 1,3,5-trimethyl-1H-imidazole-1,3-diium |
|---|---|
| PubChem CID | 58187923 |
| Molecular Formula | C6H12N2+2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 1,3,5-trimethyl-1H-imidazole-1,3-diium |
| SMILES | CC1=C[N+](C)=C[NH+]1C |
| InChI | InChI=1S/C6H11N2/c1-6-4-7(2)5-8(6)3/h4-5H,1-3H3/q+1/p+1 |
| InChIKey | CDIWYWUGTVLWJM-UHFFFAOYSA-O |
| XLogP | -0.95 |
| TPSA | 7.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|