C33H29BN2O2 — CID 148594239
12-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indolo[1,2-c]quinazoline (PubChem CID 148594239) has the molecular formula C33H29BN2O2 and a molecular weight of 496.42 g/mol. Its IUPAC name is 12-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indolo[1,2-c]quinazoline.
| Compound Name | 12-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indolo[1,2-c]quinazoline |
|---|---|
| PubChem CID | 148594239 |
| Molecular Formula | C33H29BN2O2 |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | 12-phenyl-6-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]indolo[1,2-c]quinazoline |
| SMILES | CC1(C)OB(c2ccc(-c3nc4ccccc4c4c(-c5ccccc5)c5ccccc5n34)cc2)OC1(C)C |
| InChI | InChI=1S/C33H29BN2O2/c1-32(2)33(3,4)38-34(37-32)24-20-18-23(19-21-24)31-35-27-16-10-8-14-25(27)30-29(22-12-6-5-7-13-22)26-15-9-11-17-28(26)36(30)31/h5-21H,1-4H3 |
| InChIKey | NBGFHCMCDOFSBZ-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|