C24H24BNO2 — CID 168744662
10-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[1,2-a]indole (PubChem CID 168744662) has the molecular formula C24H24BNO2 and a molecular weight of 369.27 g/mol. Its IUPAC name is 10-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[1,2-a]indole.
| Compound Name | 10-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[1,2-a]indole |
|---|---|
| PubChem CID | 168744662 |
| Molecular Formula | C24H24BNO2 |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 10-phenyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrido[1,2-a]indole |
| SMILES | CC1(C)OB(c2cccc3c(-c4ccccc4)c4ccccc4n23)OC1(C)C |
| InChI | InChI=1S/C24H24BNO2/c1-23(2)24(3,4)28-25(27-23)21-16-10-15-20-22(17-11-6-5-7-12-17)18-13-8-9-14-19(18)26(20)21/h5-16H,1-4H3 |
| InChIKey | KDBHERBMIDQECL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 22.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|