C9H14N4O3 — CID 14860690
ethyl 2-acetamido-2-(1H-pyrazol-5-ylamino)acetate (PubChem CID 14860690) has the molecular formula C9H14N4O3 and a molecular weight of 226.24 g/mol. Its IUPAC name is ethyl 2-acetamido-2-(1H-pyrazol-5-ylamino)acetate.
| Compound Name | ethyl 2-acetamido-2-(1H-pyrazol-5-ylamino)acetate |
|---|---|
| PubChem CID | 14860690 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | ethyl 2-acetamido-2-(1H-pyrazol-5-ylamino)acetate |
| SMILES | CCOC(=O)C(NC(C)=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C9H14N4O3/c1-3-16-9(15)8(11-6(2)14)12-7-4-5-10-13-7/h4-5,8H,3H2,1-2H3,(H,11,14)(H2,10,12,13) |
| InChIKey | RJYZQDBBMXXJKF-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|