C10H17N5O2 — CID 61393913
2-(carbamoylamino)-3-methyl-N-(1H-pyrazol-5-yl)pentanamide (PubChem CID 61393913) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is 2-(carbamoylamino)-3-methyl-N-(1H-pyrazol-5-yl)pentanamide.
| Compound Name | 2-(carbamoylamino)-3-methyl-N-(1H-pyrazol-5-yl)pentanamide |
|---|---|
| PubChem CID | 61393913 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 2-(carbamoylamino)-3-methyl-N-(1H-pyrazol-5-yl)pentanamide |
| SMILES | CCC(C)C(NC(N)=O)C(=O)Nc1ccn[nH]1 |
| InChI | InChI=1S/C10H17N5O2/c1-3-6(2)8(14-10(11)17)9(16)13-7-4-5-12-15-7/h4-6,8H,3H2,1-2H3,(H3,11,14,17)(H2,12,13,15,16) |
| InChIKey | FPQGDUNBGUCLLI-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |