C16H18ClN3OS — CID 148612095
1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one (PubChem CID 148612095) has the molecular formula C16H18ClN3OS and a molecular weight of 335.86 g/mol. Its IUPAC name is 1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one.
| Compound Name | 1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one |
|---|---|
| PubChem CID | 148612095 |
| Molecular Formula | C16H18ClN3OS |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one |
| SMILES | C=CC(=O)CC1CCC(Nc2nc(Cl)nc3sccc23)CC1 |
| InChI | InChI=1S/C16H18ClN3OS/c1-2-12(21)9-10-3-5-11(6-4-10)18-14-13-7-8-22-15(13)20-16(17)19-14/h2,7-8,10-11H,1,3-6,9H2,(H,18,19,20) |
| InChIKey | NEORNPHZXOZEKS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|