About 1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one
1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one (PubChem CID 148612095) has the molecular formula C16H18ClN3OS
and a molecular weight of 335.86 g/mol. Its IUPAC name is 1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one.
Molecular Properties
| Compound Name | 1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one |
| PubChem CID | 148612095 |
| Molecular Formula | C16H18ClN3OS |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.09 |
| IUPAC Name | 1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one |
| SMILES | C=CC(=O)CC1CCC(Nc2nc(Cl)nc3sccc23)CC1 |
| InChI | InChI=1S/C16H18ClN3OS/c1-2-12(21)9-10-3-5-11(6-4-10)18-14-13-7-8-22-15(13)20-16(17)19-14/h2,7-8,10-11H,1,3-6,9H2,(H,18,19,20) |
| InChIKey | NEORNPHZXOZEKS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one?
The IUPAC name of 1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one (CID 148612095) is 1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one.
What is the SMILES notation for 1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one?
The canonical SMILES for 1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one is C=CC(=O)CC1CCC(Nc2nc(Cl)nc3sccc23)CC1.
What is the InChIKey of 1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one?
The InChIKey is NEORNPHZXOZEKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18ClN3OS/c1-2-12(21)9-10-3-5-11(6-4-10)18-14-13-7-8-22-15(13)20-16(17)19-14/h2,7-8,10-11H,1,3-6,9H2,(H,18,19,20).
What are the key properties of 1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one?
1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one has a molecular weight of 335.86 g/mol, XLogP of 4.46, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(2-chlorothieno[2,3-d]pyrimidin-4-yl)amino]cyclohexyl]but-3-en-2-one is sourced from PubChem (CID 148612095), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).