C20H15F4N3O2 — CID 148616949
(3S)-4-(5-fluoroindazol-2-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one (PubChem CID 148616949) has the molecular formula C20H15F4N3O2 and a molecular weight of 405.35 g/mol. Its IUPAC name is (3S)-4-(5-fluoroindazol-2-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one.
| Compound Name | (3S)-4-(5-fluoroindazol-2-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one |
|---|---|
| PubChem CID | 148616949 |
| Molecular Formula | C20H15F4N3O2 |
| Molecular Weight | 405.35 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | (3S)-4-(5-fluoroindazol-2-yl)-3-hydroxy-1-[4-isocyano-3-(trifluoromethyl)phenyl]-3-methylbutan-2-one |
| SMILES | [C-]#[N+]c1ccc(CC(=O)[C@@](C)(O)Cn2cc3cc(F)ccc3n2)cc1C(F)(F)F |
| InChI | InChI=1S/C20H15F4N3O2/c1-19(29,11-27-10-13-9-14(21)4-6-16(13)26-27)18(28)8-12-3-5-17(25-2)15(7-12)20(22,23)24/h3-7,9-10,29H,8,11H2,1H3/t19-/m0/s1 |
| InChIKey | NFMCKVYJZOTMFI-IBGZPJMESA-N |
| XLogP | 4.31 |
| TPSA | 59.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.35 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|