C26H42N5O12P — CID 14862072
[3-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-methoxypurin-9-yl]oxy-2-(diethoxyphosphorylmethoxy)propyl] acetate (PubChem CID 14862072) has the molecular formula C26H42N5O12P and a molecular weight of 647.62 g/mol. Its IUPAC name is [3-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-methoxypurin-9-yl]oxy-2-(diethoxyphosphorylmethoxy)propyl] acetate.
| Compound Name | [3-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-methoxypurin-9-yl]oxy-2-(diethoxyphosphorylmethoxy)propyl] acetate |
|---|---|
| PubChem CID | 14862072 |
| Molecular Formula | C26H42N5O12P |
| Molecular Weight | 647.62 g/mol |
| Exact Mass | 647.26 |
| IUPAC Name | [3-[2-[bis[(2-methylpropan-2-yl)oxycarbonyl]amino]-6-methoxypurin-9-yl]oxy-2-(diethoxyphosphorylmethoxy)propyl] acetate |
| SMILES | CCOP(=O)(COC(COC(C)=O)COn1cnc2c(OC)nc(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)nc21)OCC |
| InChI | InChI=1S/C26H42N5O12P/c1-11-40-44(35,41-12-2)16-38-18(13-37-17(3)32)14-39-30-15-27-19-20(30)28-22(29-21(19)36-10)31(23(33)42-25(4,5)6)24(34)43-26(7,8)9/h15,18H,11-14,16H2,1-10H3 |
| InChIKey | GSXWLWGWOUERRZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 188.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.62 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|