About 5,6-dihydro-1H-indol-4-ol
5,6-dihydro-1H-indol-4-ol (PubChem CID 148622350) has the molecular formula C8H9NO
and a molecular weight of 135.17 g/mol. Its IUPAC name is 5,6-dihydro-1H-indol-4-ol.
Molecular Properties
| Compound Name | 5,6-dihydro-1H-indol-4-ol |
| PubChem CID | 148622350 |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.17 g/mol |
| Exact Mass | 135.07 |
| IUPAC Name | 5,6-dihydro-1H-indol-4-ol |
| SMILES | OC1=c2cc[nH]c2=CCC1 |
| InChI | InChI=1S/C8H9NO/c10-8-3-1-2-7-6(8)4-5-9-7/h2,4-5,9-10H,1,3H2 |
| InChIKey | NGMZUIFJZRJFBS-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.17 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5,6-dihydro-1H-indol-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydro-1H-indol-4-ol?
The IUPAC name of 5,6-dihydro-1H-indol-4-ol (CID 148622350) is 5,6-dihydro-1H-indol-4-ol.
What is the SMILES notation for 5,6-dihydro-1H-indol-4-ol?
The canonical SMILES for 5,6-dihydro-1H-indol-4-ol is OC1=c2cc[nH]c2=CCC1.
What is the InChIKey of 5,6-dihydro-1H-indol-4-ol?
The InChIKey is NGMZUIFJZRJFBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO/c10-8-3-1-2-7-6(8)4-5-9-7/h2,4-5,9-10H,1,3H2.
What are the key properties of 5,6-dihydro-1H-indol-4-ol?
5,6-dihydro-1H-indol-4-ol has a molecular weight of 135.17 g/mol, XLogP of 0.26, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydro-1H-indol-4-ol is sourced from PubChem (CID 148622350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).