C9H11NO — CID 163536934
5-methyl-3a,7a-dihydro-1H-indol-4-ol (PubChem CID 163536934) has the molecular formula C9H11NO and a molecular weight of 149.19 g/mol. Its IUPAC name is 5-methyl-3a,7a-dihydro-1H-indol-4-ol.
| Compound Name | 5-methyl-3a,7a-dihydro-1H-indol-4-ol |
|---|---|
| PubChem CID | 163536934 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 5-methyl-3a,7a-dihydro-1H-indol-4-ol |
| SMILES | CC1=C(O)C2C=CNC2C=C1 |
| InChI | InChI=1S/C9H11NO/c1-6-2-3-8-7(9(6)11)4-5-10-8/h2-5,7-8,10-11H,1H3 |
| InChIKey | NZZRSYWVURMCHT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |