C15H18ClF2NO2 — CID 1486250
2-(4-chloro-2-methylphenoxy)-N-cyclohexyl-2,2-difluoroacetamide (PubChem CID 1486250) has the molecular formula C15H18ClF2NO2 and a molecular weight of 317.76 g/mol. Its IUPAC name is 2-(4-chloro-2-methylphenoxy)-N-cyclohexyl-2,2-difluoroacetamide.
| Compound Name | 2-(4-chloro-2-methylphenoxy)-N-cyclohexyl-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 1486250 |
| Molecular Formula | C15H18ClF2NO2 |
| Molecular Weight | 317.76 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2-(4-chloro-2-methylphenoxy)-N-cyclohexyl-2,2-difluoroacetamide |
| SMILES | Cc1cc(Cl)ccc1OC(F)(F)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C15H18ClF2NO2/c1-10-9-11(16)7-8-13(10)21-15(17,18)14(20)19-12-5-3-2-4-6-12/h7-9,12H,2-6H2,1H3,(H,19,20) |
| InChIKey | AFSBMHSJFMHJBR-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.76 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |