C17H14Cl2O6 — CID 154145035
2,2-bis(4-chloro-2-methylphenoxy)propanedioic acid (PubChem CID 154145035) has the molecular formula C17H14Cl2O6 and a molecular weight of 385.20 g/mol. Its IUPAC name is 2,2-bis(4-chloro-2-methylphenoxy)propanedioic acid.
| Compound Name | 2,2-bis(4-chloro-2-methylphenoxy)propanedioic acid |
|---|---|
| PubChem CID | 154145035 |
| Molecular Formula | C17H14Cl2O6 |
| Molecular Weight | 385.20 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 2,2-bis(4-chloro-2-methylphenoxy)propanedioic acid |
| SMILES | Cc1cc(Cl)ccc1OC(Oc1ccc(Cl)cc1C)(C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H14Cl2O6/c1-9-7-11(18)3-5-13(9)24-17(15(20)21,16(22)23)25-14-6-4-12(19)8-10(14)2/h3-8H,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | IXXZDXHQCSDFHZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.20 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|