C19H20Cl2O5 — CID 175136143
2-hydroxyethyl 2,2-bis(4-chloro-2-methylphenoxy)propanoate (PubChem CID 175136143) has the molecular formula C19H20Cl2O5 and a molecular weight of 399.27 g/mol. Its IUPAC name is 2-hydroxyethyl 2,2-bis(4-chloro-2-methylphenoxy)propanoate.
| Compound Name | 2-hydroxyethyl 2,2-bis(4-chloro-2-methylphenoxy)propanoate |
|---|---|
| PubChem CID | 175136143 |
| Molecular Formula | C19H20Cl2O5 |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 2-hydroxyethyl 2,2-bis(4-chloro-2-methylphenoxy)propanoate |
| SMILES | Cc1cc(Cl)ccc1OC(C)(Oc1ccc(Cl)cc1C)C(=O)OCCO |
| InChI | InChI=1S/C19H20Cl2O5/c1-12-10-14(20)4-6-16(12)25-19(3,18(23)24-9-8-22)26-17-7-5-15(21)11-13(17)2/h4-7,10-11,22H,8-9H2,1-3H3 |
| InChIKey | XNEDNOFQXPIIKM-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|