C22H29NO2 — CID 148644634
4-(diethylamino)-1-[2-[(4-methoxyphenyl)methyl]phenyl]butan-1-one (PubChem CID 148644634) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is 4-(diethylamino)-1-[2-[(4-methoxyphenyl)methyl]phenyl]butan-1-one.
| Compound Name | 4-(diethylamino)-1-[2-[(4-methoxyphenyl)methyl]phenyl]butan-1-one |
|---|---|
| PubChem CID | 148644634 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | 4-(diethylamino)-1-[2-[(4-methoxyphenyl)methyl]phenyl]butan-1-one |
| SMILES | CCN(CC)CCCC(=O)c1ccccc1Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H29NO2/c1-4-23(5-2)16-8-11-22(24)21-10-7-6-9-19(21)17-18-12-14-20(25-3)15-13-18/h6-7,9-10,12-15H,4-5,8,11,16-17H2,1-3H3 |
| InChIKey | NKSINSUXCRCUEY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |