C20H22FN3O3 — CID 148644692
N-[(1R)-1-(4-fluorophenyl)ethyl]-2-[3-(2-methoxyethoxy)-1H-pyrrolo[3,4-c]pyridin-6-yl]acetamide (PubChem CID 148644692) has the molecular formula C20H22FN3O3 and a molecular weight of 371.41 g/mol. Its IUPAC name is N-[(1R)-1-(4-fluorophenyl)ethyl]-2-[3-(2-methoxyethoxy)-1H-pyrrolo[3,4-c]pyridin-6-yl]acetamide.
| Compound Name | N-[(1R)-1-(4-fluorophenyl)ethyl]-2-[3-(2-methoxyethoxy)-1H-pyrrolo[3,4-c]pyridin-6-yl]acetamide |
|---|---|
| PubChem CID | 148644692 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N-[(1R)-1-(4-fluorophenyl)ethyl]-2-[3-(2-methoxyethoxy)-1H-pyrrolo[3,4-c]pyridin-6-yl]acetamide |
| SMILES | COCCOC1=NCc2cc(CC(=O)N[C@H](C)c3ccc(F)cc3)ncc21 |
| InChI | InChI=1S/C20H22FN3O3/c1-13(14-3-5-16(21)6-4-14)24-19(25)10-17-9-15-11-23-20(18(15)12-22-17)27-8-7-26-2/h3-6,9,12-13H,7-8,10-11H2,1-2H3,(H,24,25)/t13-/m1/s1 |
| InChIKey | NKSOLCFPTZCBRL-CYBMUJFWSA-N |
| XLogP | 2.56 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|