C18H19FN4O — CID 157258389
N-[(1R)-1-(4-fluorophenyl)ethyl]-2-(3-methylimino-1,2-dihydropyrrolo[3,4-c]pyridin-6-yl)acetamide (PubChem CID 157258389) has the molecular formula C18H19FN4O and a molecular weight of 326.38 g/mol. Its IUPAC name is N-[(1R)-1-(4-fluorophenyl)ethyl]-2-(3-methylimino-1,2-dihydropyrrolo[3,4-c]pyridin-6-yl)acetamide.
| Compound Name | N-[(1R)-1-(4-fluorophenyl)ethyl]-2-(3-methylimino-1,2-dihydropyrrolo[3,4-c]pyridin-6-yl)acetamide |
|---|---|
| PubChem CID | 157258389 |
| Molecular Formula | C18H19FN4O |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | N-[(1R)-1-(4-fluorophenyl)ethyl]-2-(3-methylimino-1,2-dihydropyrrolo[3,4-c]pyridin-6-yl)acetamide |
| SMILES | C/N=C1\NCc2cc(CC(=O)N[C@H](C)c3ccc(F)cc3)ncc21 |
| InChI | InChI=1S/C18H19FN4O/c1-11(12-3-5-14(19)6-4-12)23-17(24)8-15-7-13-9-22-18(20-2)16(13)10-21-15/h3-7,10-11H,8-9H2,1-2H3,(H,20,22)(H,23,24)/t11-/m1/s1 |
| InChIKey | AXDVYLBYSDXQOX-LLVKDONJSA-N |
| XLogP | 2.12 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|