C55H36N4 — CID 148644834
15-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-8,8-diphenyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene (PubChem CID 148644834) has the molecular formula C55H36N4 and a molecular weight of 752.92 g/mol. Its IUPAC name is 15-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-8,8-diphenyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene.
| Compound Name | 15-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-8,8-diphenyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene |
|---|---|
| PubChem CID | 148644834 |
| Molecular Formula | C55H36N4 |
| Molecular Weight | 752.92 g/mol |
| Exact Mass | 752.29 |
| IUPAC Name | 15-[3-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]phenyl]-8,8-diphenyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4cccc(-c5cc6c7c(cccc7n5)C(c5ccccc5)(c5ccccc5)c5ccccc5-6)c4)c3)n2)cc1 |
| InChI | InChI=1S/C55H36N4/c1-5-18-37(19-6-1)52-57-53(38-20-7-2-8-21-38)59-54(58-52)42-25-16-23-40(35-42)39-22-15-24-41(34-39)50-36-46-45-30-13-14-31-47(45)55(43-26-9-3-10-27-43,44-28-11-4-12-29-44)48-32-17-33-49(56-50)51(46)48/h1-36H |
| InChIKey | NKTGRBPAHUINSM-UHFFFAOYSA-N |
| XLogP | 13.12 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.92 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |