C19H25N5O2 — CID 148647398
[[7-methoxy-4-(1-propylcyclopropyl)-1H-benzimidazol-2-yl]amino]-(1-methylpyrazol-4-yl)methanol (PubChem CID 148647398) has the molecular formula C19H25N5O2 and a molecular weight of 355.44 g/mol. Its IUPAC name is [[7-methoxy-4-(1-propylcyclopropyl)-1H-benzimidazol-2-yl]amino]-(1-methylpyrazol-4-yl)methanol.
| Compound Name | [[7-methoxy-4-(1-propylcyclopropyl)-1H-benzimidazol-2-yl]amino]-(1-methylpyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 148647398 |
| Molecular Formula | C19H25N5O2 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | [[7-methoxy-4-(1-propylcyclopropyl)-1H-benzimidazol-2-yl]amino]-(1-methylpyrazol-4-yl)methanol |
| SMILES | CCCC1(c2ccc(OC)c3[nH]c(NC(O)c4cnn(C)c4)nc23)CC1 |
| InChI | InChI=1S/C19H25N5O2/c1-4-7-19(8-9-19)13-5-6-14(26-3)16-15(13)21-18(22-16)23-17(25)12-10-20-24(2)11-12/h5-6,10-11,17,25H,4,7-9H2,1-3H3,(H2,21,22,23) |
| InChIKey | NLFUQOCNXUITNQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|