C18H15ClFN3O — CID 148649359
4-[2-(4-chlorophenyl)ethyl]-5-fluoro-2-(pyridin-2-ylmethoxy)pyrimidine (PubChem CID 148649359) has the molecular formula C18H15ClFN3O and a molecular weight of 343.79 g/mol. Its IUPAC name is 4-[2-(4-chlorophenyl)ethyl]-5-fluoro-2-(pyridin-2-ylmethoxy)pyrimidine.
| Compound Name | 4-[2-(4-chlorophenyl)ethyl]-5-fluoro-2-(pyridin-2-ylmethoxy)pyrimidine |
|---|---|
| PubChem CID | 148649359 |
| Molecular Formula | C18H15ClFN3O |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | 4-[2-(4-chlorophenyl)ethyl]-5-fluoro-2-(pyridin-2-ylmethoxy)pyrimidine |
| SMILES | Fc1cnc(OCc2ccccn2)nc1CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15ClFN3O/c19-14-7-4-13(5-8-14)6-9-17-16(20)11-22-18(23-17)24-12-15-3-1-2-10-21-15/h1-5,7-8,10-11H,6,9,12H2 |
| InChIKey | NLPTVLQELZDWKN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |