C25H25F5N2O — CID 148650070
(4R)-3-(3,3-difluorocyclobutyl)-4,7,7-trimethyl-4-[3-(trifluoromethyl)phenyl]-1,6,8,9-tetrahydrobenzo[f]indazol-5-one (PubChem CID 148650070) has the molecular formula C25H25F5N2O and a molecular weight of 464.48 g/mol. Its IUPAC name is (4R)-3-(3,3-difluorocyclobutyl)-4,7,7-trimethyl-4-[3-(trifluoromethyl)phenyl]-1,6,8,9-tetrahydrobenzo[f]indazol-5-one.
| Compound Name | (4R)-3-(3,3-difluorocyclobutyl)-4,7,7-trimethyl-4-[3-(trifluoromethyl)phenyl]-1,6,8,9-tetrahydrobenzo[f]indazol-5-one |
|---|---|
| PubChem CID | 148650070 |
| Molecular Formula | C25H25F5N2O |
| Molecular Weight | 464.48 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | (4R)-3-(3,3-difluorocyclobutyl)-4,7,7-trimethyl-4-[3-(trifluoromethyl)phenyl]-1,6,8,9-tetrahydrobenzo[f]indazol-5-one |
| SMILES | CC1(C)CC(=O)C2=C(Cc3[nH]nc(C4CC(F)(F)C4)c3[C@@]2(C)c2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C25H25F5N2O/c1-22(2)9-13-7-17-20(21(32-31-17)14-10-24(26,27)11-14)23(3,19(13)18(33)12-22)15-5-4-6-16(8-15)25(28,29)30/h4-6,8,14H,7,9-12H2,1-3H3,(H,31,32)/t23-/m0/s1 |
| InChIKey | NLTDPVLFELAZOO-QHCPKHFHSA-N |
| XLogP | 6.49 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.48 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |