C23H25F2N3O — CID 123192191
3-(3,3-difluorocyclobutyl)-4,7,7-trimethyl-4-phenyl-2,4a,6,8-tetrahydropyrazolo[3,4-b]quinolin-5-one (PubChem CID 123192191) has the molecular formula C23H25F2N3O and a molecular weight of 397.47 g/mol. Its IUPAC name is 3-(3,3-difluorocyclobutyl)-4,7,7-trimethyl-4-phenyl-2,4a,6,8-tetrahydropyrazolo[3,4-b]quinolin-5-one.
| Compound Name | 3-(3,3-difluorocyclobutyl)-4,7,7-trimethyl-4-phenyl-2,4a,6,8-tetrahydropyrazolo[3,4-b]quinolin-5-one |
|---|---|
| PubChem CID | 123192191 |
| Molecular Formula | C23H25F2N3O |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 3-(3,3-difluorocyclobutyl)-4,7,7-trimethyl-4-phenyl-2,4a,6,8-tetrahydropyrazolo[3,4-b]quinolin-5-one |
| SMILES | CC1(C)CC(=O)C2C(=Nc3n[nH]c(C4CC(F)(F)C4)c3C2(C)c2ccccc2)C1 |
| InChI | InChI=1S/C23H25F2N3O/c1-21(2)11-15-17(16(29)12-21)22(3,14-7-5-4-6-8-14)18-19(27-28-20(18)26-15)13-9-23(24,25)10-13/h4-8,13,17H,9-12H2,1-3H3,(H,27,28) |
| InChIKey | ATZQGXODNOYPHF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 58.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |