C18H13Cl2FN2O2 — CID 148665345
1-(2,4-dichlorophenyl)-5-[(3-fluoro-4-methoxyphenyl)methyl]pyrazole-3-carbaldehyde (PubChem CID 148665345) has the molecular formula C18H13Cl2FN2O2 and a molecular weight of 379.22 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-5-[(3-fluoro-4-methoxyphenyl)methyl]pyrazole-3-carbaldehyde.
| Compound Name | 1-(2,4-dichlorophenyl)-5-[(3-fluoro-4-methoxyphenyl)methyl]pyrazole-3-carbaldehyde |
|---|---|
| PubChem CID | 148665345 |
| Molecular Formula | C18H13Cl2FN2O2 |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 378.03 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-5-[(3-fluoro-4-methoxyphenyl)methyl]pyrazole-3-carbaldehyde |
| SMILES | COc1ccc(Cc2cc(C=O)nn2-c2ccc(Cl)cc2Cl)cc1F |
| InChI | InChI=1S/C18H13Cl2FN2O2/c1-25-18-5-2-11(7-16(18)21)6-14-9-13(10-24)22-23(14)17-4-3-12(19)8-15(17)20/h2-5,7-10H,6H2,1H3 |
| InChIKey | NOPRZUQBFSSJJH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|