C15H22O2 — CID 14866902
(1R,4S,4aR,7R,7aS)-1-(cyclopenten-1-yl)-4,7-dimethyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-3-one (PubChem CID 14866902) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (1R,4S,4aR,7R,7aS)-1-(cyclopenten-1-yl)-4,7-dimethyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-3-one.
| Compound Name | (1R,4S,4aR,7R,7aS)-1-(cyclopenten-1-yl)-4,7-dimethyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-3-one |
|---|---|
| PubChem CID | 14866902 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (1R,4S,4aR,7R,7aS)-1-(cyclopenten-1-yl)-4,7-dimethyl-4,4a,5,6,7,7a-hexahydro-1H-cyclopenta[c]pyran-3-one |
| SMILES | C[C@@H]1CC[C@@H]2[C@H]1[C@H](C1=CCCC1)OC(=O)[C@H]2C |
| InChI | InChI=1S/C15H22O2/c1-9-7-8-12-10(2)15(16)17-14(13(9)12)11-5-3-4-6-11/h5,9-10,12-14H,3-4,6-8H2,1-2H3/t9-,10+,12+,13+,14+/m1/s1 |
| InChIKey | DIBIZJKDEUDDRM-ZZEGJQGJSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|