C22H29N3 — CID 14867065
2-(1-decyl-4-pyridinylidene)benzimidazole (PubChem CID 14867065) has the molecular formula C22H29N3 and a molecular weight of 335.50 g/mol. Its IUPAC name is 2-(1-decyl-4-pyridinylidene)benzimidazole.
| Compound Name | 2-(1-decyl-4-pyridinylidene)benzimidazole |
|---|---|
| PubChem CID | 14867065 |
| Molecular Formula | C22H29N3 |
| Molecular Weight | 335.50 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 2-(1-decyl-4-pyridinylidene)benzimidazole |
| SMILES | CCCCCCCCCCN1C=CC(=C2N=c3ccccc3=N2)C=C1 |
| InChI | InChI=1S/C22H29N3/c1-2-3-4-5-6-7-8-11-16-25-17-14-19(15-18-25)22-23-20-12-9-10-13-21(20)24-22/h9-10,12-15,17-18H,2-8,11,16H2,1H3 |
| InChIKey | QMPARCRRQCQRMN-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|