C13H17FN2 — CID 68758392
3-(5-fluoro-7H-indol-3-yl)-N,N-dimethylpropan-1-amine (PubChem CID 68758392) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is 3-(5-fluoro-7H-indol-3-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(5-fluoro-7H-indol-3-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 68758392 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 3-(5-fluoro-7H-indol-3-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCC1=CN=C2CC=C(F)C=C12 |
| InChI | InChI=1S/C13H17FN2/c1-16(2)7-3-4-10-9-15-13-6-5-11(14)8-12(10)13/h5,8-9H,3-4,6-7H2,1-2H3 |
| InChIKey | AJGOCYBERFBFTB-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |