C26H35N3 — CID 14922173
2-[2-(1-decyl-4-pyridinylidene)ethylidene]-5,6-dimethylbenzimidazole (PubChem CID 14922173) has the molecular formula C26H35N3 and a molecular weight of 389.59 g/mol. Its IUPAC name is 2-[2-(1-decyl-4-pyridinylidene)ethylidene]-5,6-dimethylbenzimidazole.
| Compound Name | 2-[2-(1-decyl-4-pyridinylidene)ethylidene]-5,6-dimethylbenzimidazole |
|---|---|
| PubChem CID | 14922173 |
| Molecular Formula | C26H35N3 |
| Molecular Weight | 389.59 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | 2-[2-(1-decyl-4-pyridinylidene)ethylidene]-5,6-dimethylbenzimidazole |
| SMILES | CCCCCCCCCCN1C=CC(=CC=C2N=c3cc(C)c(C)cc3=N2)C=C1 |
| InChI | InChI=1S/C26H35N3/c1-4-5-6-7-8-9-10-11-16-29-17-14-23(15-18-29)12-13-26-27-24-19-21(2)22(3)20-25(24)28-26/h12-15,17-20H,4-11,16H2,1-3H3 |
| InChIKey | ACMWTPLONPEZII-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.59 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|