C17H14N4O2 — CID 14867812
ethyl 5-methyl-6,10,12,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,8,11(16),12,14-octaene-4-carboxylate (PubChem CID 14867812) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is ethyl 5-methyl-6,10,12,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,8,11(16),12,14-octaene-4-carboxylate.
| Compound Name | ethyl 5-methyl-6,10,12,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,8,11(16),12,14-octaene-4-carboxylate |
|---|---|
| PubChem CID | 14867812 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | ethyl 5-methyl-6,10,12,17-tetrazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(17),2,4,6,8,11(16),12,14-octaene-4-carboxylate |
| SMILES | CCOC(=O)c1cc2c(ccn3c4ncccc4nc23)nc1C |
| InChI | InChI=1S/C17H14N4O2/c1-3-23-17(22)11-9-12-13(19-10(11)2)6-8-21-15(12)20-14-5-4-7-18-16(14)21/h4-9H,3H2,1-2H3 |
| InChIKey | BCYREWIRCQJJBJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |