C16H27N5O2 — CID 148684222
tert-butyl (3S)-3-(4a,5,6,7,8,8a-hexahydro-3H-pyrido[4,3-d]pyrimidin-4-ylideneamino)pyrrolidine-1-carboxylate (PubChem CID 148684222) has the molecular formula C16H27N5O2 and a molecular weight of 321.43 g/mol. Its IUPAC name is tert-butyl (3S)-3-(4a,5,6,7,8,8a-hexahydro-3H-pyrido[4,3-d]pyrimidin-4-ylideneamino)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-(4a,5,6,7,8,8a-hexahydro-3H-pyrido[4,3-d]pyrimidin-4-ylideneamino)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 148684222 |
| Molecular Formula | C16H27N5O2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.22 |
| IUPAC Name | tert-butyl (3S)-3-(4a,5,6,7,8,8a-hexahydro-3H-pyrido[4,3-d]pyrimidin-4-ylideneamino)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](/N=C2\NC=NC3CCNCC23)C1 |
| InChI | InChI=1S/C16H27N5O2/c1-16(2,3)23-15(22)21-7-5-11(9-21)20-14-12-8-17-6-4-13(12)18-10-19-14/h10-13,17H,4-9H2,1-3H3,(H,18,19,20)/t11-,12?,13?/m0/s1 |
| InChIKey | NSFFMPFLNKEPFJ-HIFPTAJRSA-N |
| XLogP | 1.00 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|