C15H27N5O2 — CID 145316463
tert-butyl 2-(2-imino-6-methylpiperazine-1-carboximidoyl)pyrrolidine-1-carboxylate (PubChem CID 145316463) has the molecular formula C15H27N5O2 and a molecular weight of 309.41 g/mol. Its IUPAC name is tert-butyl 2-(2-imino-6-methylpiperazine-1-carboximidoyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-(2-imino-6-methylpiperazine-1-carboximidoyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 145316463 |
| Molecular Formula | C15H27N5O2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.22 |
| IUPAC Name | tert-butyl 2-(2-imino-6-methylpiperazine-1-carboximidoyl)pyrrolidine-1-carboxylate |
| SMILES | [H]/N=C1\CNCC(C)N1/C(=N/[H])C1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27N5O2/c1-10-8-18-9-12(16)20(10)13(17)11-6-5-7-19(11)14(21)22-15(2,3)4/h10-11,16-18H,5-9H2,1-4H3/b16-12+,17-13+ |
| InChIKey | VOKGTMCPSSGPMK-UNZYHPAISA-N |
| XLogP | 1.63 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|