C11H20ClN3O3 — CID 14868944
1,2-dimethyl-3-[(3-methyl-3-nitrobutan-2-yl)oxymethyl]imidazol-1-ium chloride (PubChem CID 14868944) has the molecular formula C11H20ClN3O3 and a molecular weight of 277.75 g/mol. Its IUPAC name is 1,2-dimethyl-3-[(3-methyl-3-nitrobutan-2-yl)oxymethyl]imidazol-1-ium chloride.
| Compound Name | 1,2-dimethyl-3-[(3-methyl-3-nitrobutan-2-yl)oxymethyl]imidazol-1-ium chloride |
|---|---|
| PubChem CID | 14868944 |
| Molecular Formula | C11H20ClN3O3 |
| Molecular Weight | 277.75 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 1,2-dimethyl-3-[(3-methyl-3-nitrobutan-2-yl)oxymethyl]imidazol-1-ium chloride |
| SMILES | Cc1n(COC(C)C(C)(C)[N+](=O)[O-])cc[n+]1C.[Cl-] |
| InChI | InChI=1S/C11H20N3O3.ClH/c1-9(11(3,4)14(15)16)17-8-13-7-6-12(5)10(13)2;/h6-7,9H,8H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | CPBMDDSTYSRACX-UHFFFAOYSA-M |
| XLogP | -1.96 |
| TPSA | 61.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.75 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|