C15H20O4 — CID 14869763
diethyl 2-[(2E,4E,6E)-octa-2,4,6-trienylidene]propanedioate (PubChem CID 14869763) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is diethyl 2-[(2E,4E,6E)-octa-2,4,6-trienylidene]propanedioate.
| Compound Name | diethyl 2-[(2E,4E,6E)-octa-2,4,6-trienylidene]propanedioate |
|---|---|
| PubChem CID | 14869763 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | diethyl 2-[(2E,4E,6E)-octa-2,4,6-trienylidene]propanedioate |
| SMILES | C/C=C/C=C/C=C/C=C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C15H20O4/c1-4-7-8-9-10-11-12-13(14(16)18-5-2)15(17)19-6-3/h4,7-12H,5-6H2,1-3H3/b7-4+,9-8+,11-10+ |
| InChIKey | OPRFPCHXHPECFZ-XWXHWXBNSA-N |
| XLogP | 2.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|