C27H36O — CID 148707004
(9R)-9-(3-methylphenyl)-9-[4-(3-methylphenyl)butyl]-6-oxaspiro[4.5]decane (PubChem CID 148707004) has the molecular formula C27H36O and a molecular weight of 376.58 g/mol. Its IUPAC name is (9R)-9-(3-methylphenyl)-9-[4-(3-methylphenyl)butyl]-6-oxaspiro[4.5]decane.
| Compound Name | (9R)-9-(3-methylphenyl)-9-[4-(3-methylphenyl)butyl]-6-oxaspiro[4.5]decane |
|---|---|
| PubChem CID | 148707004 |
| Molecular Formula | C27H36O |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 376.28 |
| IUPAC Name | (9R)-9-(3-methylphenyl)-9-[4-(3-methylphenyl)butyl]-6-oxaspiro[4.5]decane |
| SMILES | Cc1cccc(CCCC[C@@]2(c3cccc(C)c3)CCOC3(CCCC3)C2)c1 |
| InChI | InChI=1S/C27H36O/c1-22-9-7-12-24(19-22)11-3-4-14-26(25-13-8-10-23(2)20-25)17-18-28-27(21-26)15-5-6-16-27/h7-10,12-13,19-20H,3-6,11,14-18,21H2,1-2H3/t26-/m1/s1 |
| InChIKey | NWMCYCYLJMKQKP-AREMUKBSSA-N |
| XLogP | 7.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|