C24H29F2NO — CID 152845963
3-[(9R)-9-[4-(3,5-difluorophenyl)butyl]-6-oxaspiro[4.5]decan-9-yl]pyridine (PubChem CID 152845963) has the molecular formula C24H29F2NO and a molecular weight of 385.50 g/mol. Its IUPAC name is 3-[(9R)-9-[4-(3,5-difluorophenyl)butyl]-6-oxaspiro[4.5]decan-9-yl]pyridine.
| Compound Name | 3-[(9R)-9-[4-(3,5-difluorophenyl)butyl]-6-oxaspiro[4.5]decan-9-yl]pyridine |
|---|---|
| PubChem CID | 152845963 |
| Molecular Formula | C24H29F2NO |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.22 |
| IUPAC Name | 3-[(9R)-9-[4-(3,5-difluorophenyl)butyl]-6-oxaspiro[4.5]decan-9-yl]pyridine |
| SMILES | Fc1cc(F)cc(CCCC[C@@]2(c3cccnc3)CCOC3(CCCC3)C2)c1 |
| InChI | InChI=1S/C24H29F2NO/c25-21-14-19(15-22(26)16-21)6-1-2-8-23(20-7-5-12-27-17-20)11-13-28-24(18-23)9-3-4-10-24/h5,7,12,14-17H,1-4,6,8-11,13,18H2/t23-/m1/s1 |
| InChIKey | TUAXJHNVRNJFFD-HSZRJFAPSA-N |
| XLogP | 6.13 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|