C25H28F6N2O — CID 153177049
5-[4-(9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl)butyl]-2,3-bis(trifluoromethyl)pyridine (PubChem CID 153177049) has the molecular formula C25H28F6N2O and a molecular weight of 486.50 g/mol. Its IUPAC name is 5-[4-(9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl)butyl]-2,3-bis(trifluoromethyl)pyridine.
| Compound Name | 5-[4-(9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl)butyl]-2,3-bis(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 153177049 |
| Molecular Formula | C25H28F6N2O |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | 5-[4-(9-pyridin-2-yl-6-oxaspiro[4.5]decan-9-yl)butyl]-2,3-bis(trifluoromethyl)pyridine |
| SMILES | FC(F)(F)c1cc(CCCCC2(c3ccccn3)CCOC3(CCCC3)C2)cnc1C(F)(F)F |
| InChI | InChI=1S/C25H28F6N2O/c26-24(27,28)19-15-18(16-33-21(19)25(29,30)31)7-1-3-9-22(20-8-2-6-13-32-20)12-14-34-23(17-22)10-4-5-11-23/h2,6,8,13,15-16H,1,3-5,7,9-12,14,17H2 |
| InChIKey | WFJZQXUSURONPN-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|